2-IODO-5'-ETHYLCARBOXAMIDOADENOSINE
2-IODO-5'-ETHYLCARBOXAMIDOADENOSINE structure
|
Common Name | 2-IODO-5'-ETHYLCARBOXAMIDOADENOSINE | ||
|---|---|---|---|---|
| CAS Number | 141018-29-3 | Molecular Weight | 464.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17IN6O5 | Melting Point | 218-220ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Iodo-5'-ethylcarboxamido Adenosine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 218-220ºC |
|---|---|
| Molecular Formula | C13H17IN6O5 |
| Molecular Weight | 464.21600 |
| Exact Mass | 464.03100 |
| PSA | 157.64000 |
| LogP | 0.35050 |
| Index of Refraction | 1.902 |
| InChIKey | YEBHQRSEUJCFMN-MYLVMTIQSA-N |
| SMILES | CCNC(=O)C1OC(n2cnc3c(N)nc(I)nc32)C(O)C1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2S,3R,5R)-5-(6-amino-2-iodopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-Iodo-5'-ethylcarboxamido Adenosine have? |
| A: English synonyms of 2-Iodo-5'-ethylcarboxamido Adenosine: (2S,3R,5R)-5-(6-amino-2-iodopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide. |
| Q: What is the melting point of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: Melting point of 2-Iodo-5'-ethylcarboxamido Adenosine is 218-220ºC. |
| Q: What is the molecular weight of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: Molecular weight of 2-Iodo-5'-ethylcarboxamido Adenosine is 464.21600. |
| Q: What is the LogP of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: LogP of 2-Iodo-5'-ethylcarboxamido Adenosine is 0.35050. |
| Q: What is the molecular formula of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: Molecular formula of 2-Iodo-5'-ethylcarboxamido Adenosine is C13H17IN6O5. |
| Q: What is the CAS number of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: CAS number of 2-Iodo-5'-ethylcarboxamido Adenosine is 141018-29-3. |
| Q: What is the InChIKey of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: InChIKey of 2-Iodo-5'-ethylcarboxamido Adenosine is YEBHQRSEUJCFMN-MYLVMTIQSA-N. |
| Q: What is the polar surface area (PSA) of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: Polar surface area (PSA) of 2-Iodo-5'-ethylcarboxamido Adenosine is 157.64000. |
| Q: What is the English name of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: The English name of 2-Iodo-5'-ethylcarboxamido Adenosine is 2-Iodo-5'-ethylcarboxamido Adenosine. |
| Q: What are the upstream materials of 2-Iodo-5'-ethylcarboxamido Adenosine? |
| A: Related upstream materials(CAS) of 2-Iodo-5'-ethylcarboxamido Adenosine: 162936-24-5;75-04-7;35109-88-7;141018-25-9;141018-26-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |