2-methyl-N-naphthalen-1-yl-N-phenylprop-2-enamide structure
|
Common Name | 2-methyl-N-naphthalen-1-yl-N-phenylprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 141029-31-4 | Molecular Weight | 287.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17NO | Melting Point | 112-118ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2-methyl-N-naphthalen-1-yl-N-phenylprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 112-118ºC(lit.) |
|---|---|
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.35500 |
| Exact Mass | 287.13100 |
| PSA | 20.31000 |
| LogP | 5.08060 |
| InChIKey | BLVLNPMGKHGHJN-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)N(c1ccccc1)c1cccc2ccccc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(1-Naphthyl)-N-phenylmethacrylamide |
| 2-Propenamide,2-methyl-N-1-naphthalenyl-N-phenyl |