bis(3,5,5-trimethylhexyl) phthalate structure
|
Common Name | bis(3,5,5-trimethylhexyl) phthalate | ||
|---|---|---|---|---|
| CAS Number | 14103-61-8 | Molecular Weight | 418.60900 | |
| Density | 0.973g/cm3 | Boiling Point | 463.3ºC at 760 mmHg | |
| Molecular Formula | C26H42O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | bis(3,5,5-trimethylhexyl) phthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 463.3ºC at 760 mmHg |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.60900 |
| Flash Point | 214.9ºC |
| Exact Mass | 418.30800 |
| PSA | 52.60000 |
| LogP | 6.92500 |
| Vapour Pressure | 9.15E-09mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | GDJOUZYAIHWDCA-UHFFFAOYSA-N |
| SMILES | CC(CCOC(=O)c1ccccc1C(=O)OCCC(C)CC(C)(C)C)CC(C)(C)C |
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Di-isononyl phthalate |
| diisoindoledibenzene |
| dicarbahemiporphyrazine |