N-[[(1R,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]benzamide structure
|
Common Name | N-[[(1R,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 141034-11-9 | Molecular Weight | 326.41300 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[(1R,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.41300 |
| Exact Mass | 326.10900 |
| PSA | 103.98000 |
| LogP | 3.32540 |
| Index of Refraction | 1.684 |
| InChIKey | SKMAMDAEIBRBMU-HZPDHXFCSA-N |
| SMILES | O=C(NC(=S)NC1c2ccccc2CCC1O)c1ccccc1 |
|
~81%
N-[[(1R,2R)-2-h... CAS#:141034-11-9 |
| Literature: Shukla, Upendra K.; Singh, Raieshwar; Khanna, J. M.; Saxena, Anil K.; Singh, Hemant K.; et al. Collection of Czechoslovak Chemical Communications, 1992 , vol. 57, # 2 p. 415 - 424 |
| N-benzoyl-N'-(2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)-thiourea |
| trans-N-(2-Hydroxy-1,2,3,4-tetrahydronaphthalene-1-yl)-N'-benzoylthiourea |
| N-(((2-Hydroxy-1,2,3,4-tetrahydro-1-naphthalenyl)amino)thioxomethyl)benzamide (E) |
| Benzamide,N-(((2-hydroxy-1,2,3,4-tetrahydro-1-naphthalenyl)amino)thioxomethyl)-,(E) |