1-Propanol, 3,3,3-trifluoro-bis-2,2-(trifluoromethyl)- structure
|
Common Name | 1-Propanol, 3,3,3-trifluoro-bis-2,2-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 14117-17-0 | Molecular Weight | 250.06200 | |
| Density | 1.584g/cm3 | Boiling Point | 132.2ºC at 760mmHg | |
| Molecular Formula | C5H3F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.8ºC | |
| Name | 3,3,3-trifluoro-2,2-bis(trifluoromethyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.584g/cm3 |
|---|---|
| Boiling Point | 132.2ºC at 760mmHg |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06200 |
| Flash Point | 33.8ºC |
| Exact Mass | 250.00400 |
| PSA | 20.23000 |
| LogP | 2.65200 |
| Vapour Pressure | 3.94mmHg at 25°C |
| Index of Refraction | 1.284 |
| InChIKey | IOOVIIUXHLMNFE-UHFFFAOYSA-N |
| SMILES | OCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2905590090 |
|---|
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,3,3-trifluoro-2,2-bis-trifluoromethyl-propan-1-ol |
| (Perfluor-tert-butyl)methanol |
| 1-Propanol,3,3,3-trifluoro-bis-2,2-(trifluoromethyl) |
| 3,3,3-Trifluor-2,2-bis-trifluormethyl-propan-1-ol |