4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide
4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide structure
|
Common Name | 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 14122-46-4 | Molecular Weight | 358.25400 | |
| Density | N/A | Boiling Point | 451.5ºC at 760mmHg | |
| Molecular Formula | C13H16BrN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 451.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.25400 |
| Flash Point | 226.9ºC |
| Exact Mass | 357.01500 |
| PSA | 112.55000 |
| LogP | 3.38550 |
| Vapour Pressure | 2.41E-08mmHg at 25°C |
| InChIKey | WQGHDCNSCAPODD-UHFFFAOYSA-N |
| SMILES | Br.N=C(N)SCCCCN1C(=O)c2ccccc2C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~98%
4-(1,3-dioxoiso... CAS#:14122-46-4 |
| Literature: Karginov, Vladimir A.; Yohannes, Adiamseged; Robinson, Tanisha M.; Fahmi, Nour Eddine; Alibek, Kenneth; Hecht, Sidney M. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 1 p. 33 - 40 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4-phthalimidobutyl)isothiouronium hydrobromide |
| 2-(4-Phthalimidobutyl)-2-thiopseudourea hydrobromide |
| S-(4-phthalimido-butyl)-isothiourea,hydrobromide |
| 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate hydrobromide |
| S-(4-Phthalimido-butyl)-isothioharnstoff,Hydrobromid |
| (4-phthalimidobutyl)isothiuronium hydrobromide |
| Pseudourea,2-(4-phthalimidobutyl)-2-thio-,hydrobromide |
| S-(4-Phthalimido-butyl)-isothiouronium-bromid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 14122-46-4? |
| A: Chinese name of 14122-46-4 is 14122-46-4. |
| Q: What are the upstream materials of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: Related upstream materials(CAS) of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide: 5394-18-3. |
| Q: What is the SMILES notation of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: SMILES notation of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is Br.N=C(N)SCCCCN1C(=O)c2ccccc2C1=O. |
| Q: What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: InChIKey of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is WQGHDCNSCAPODD-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: The English name of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide. |
| Q: What is the CAS number of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: CAS number of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is 14122-46-4. |
| Q: What is the molecular weight of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: Molecular weight of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is 358.25400. |
| Q: What is the LogP of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: LogP of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is 3.38550. |
| Q: What is the molecular formula of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: Molecular formula of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is C13H16BrN3O2S. |
| Q: What is the boiling point of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide? |
| A: Boiling point of 4-(1,3-dioxoisoindol-2-yl)butyl carbamimidothioate,hydrobromide is 451.5ºC at 760mmHg. |