N-(4-bromobutyl)phthalimide structure
|
Common Name | N-(4-bromobutyl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 5394-18-3 | Molecular Weight | 282.133 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 381.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H12BrNO2 | Melting Point | 76-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 184.4±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(4-Bromobutyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.3±25.0 °C at 760 mmHg |
| Melting Point | 76-80 °C(lit.) |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.133 |
| Flash Point | 184.4±23.2 °C |
| Exact Mass | 281.005127 |
| PSA | 37.38000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | UXFWTIGUWHJKDD-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCBr |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29251995 |
|
~91%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: Hou, Duen-Ren; Cheng, Hsiu-Yi; Wang, Eng-Chi Journal of Organic Chemistry, 2004 , vol. 69, # 18 p. 6094 - 6099 |
|
~92%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: Gillet, Jean-Philippe; Ruppin, Chirstophe Patent: US2004/176613 A1, 2004 ; Location in patent: Page 3 ; |
|
~%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: WO2011/121055 A1, ; Page/Page column 24 ; WO 2011/121055 A1 |
|
~%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: US5610195 A1, ; |
|
~82%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: Russian Journal of Applied Chemistry, , vol. 73, # 12 p. 2106 - 2108 |
|
~%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: Organic Letters, , vol. 13, # 4 p. 764 - 767 |
|
~%
N-(4-bromobutyl... CAS#:5394-18-3 |
| Literature: WO2011/121055 A1, ; WO 2011/121055 A1 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Antibody purification using affinity chromatography: a case study with a monoclonal antibody to ractopamine.
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 971 , 10-3, (2014) The application of antibodies to small molecules in the field of bioanalytics requires antibodies with stable biological activity and high purity; thus, there is a growing interest in developing rapid... |
| 2-(4-Bromobutyl)-1,3-isoindolinedione |
| 4-phthalimido-1-bromobutane |
| 2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione |
| MFCD00005905 |
| 2-(4-bromobutyl)isoindole-1,3(2H)dione |
| 1H-Isoindole-1,3(2H)-dione, 2-(4-bromobutyl)- |
| N-(4-bromobutyl)phthalimide |
| N-(4-bromobutyl)-1H-isoindole-1,3(2H)-dione |
| N-(4-Brompobutyl)phthalimide |
| EINECS 226-401-2 |
| 1-Phthalimido-4-bromobutane |
| N-(4-bromo-1-butyl)-phthalimide |
| 4-Bromobutylphthalimide |
| 2-(4-Bromobutyl)isoindoline-1,3-dione |
| Phthalimide,N-(4-bromobutyl) |