3-METHYL-4-NITROBENZYL BROMIDE structure
|
Common Name | 3-METHYL-4-NITROBENZYL BROMIDE | ||
|---|---|---|---|---|
| CAS Number | 141281-38-1 | Molecular Weight | 230.05900 | |
| Density | 1.564g/cm3 | Boiling Point | 310.7ºC at 760 mmHg | |
| Molecular Formula | C8H8BrNO2 | Melting Point | 46-48ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >221 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-(bromomethyl)-2-methyl-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.564g/cm3 |
|---|---|
| Boiling Point | 310.7ºC at 760 mmHg |
| Melting Point | 46-48ºC(lit.) |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.05900 |
| Flash Point | >221 °F |
| Exact Mass | 228.97400 |
| PSA | 45.82000 |
| LogP | 3.32130 |
| Vapour Pressure | 0.00108mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | WOUWGCLQOJPWHS-UHFFFAOYSA-N |
| SMILES | Cc1cc(CBr)ccc1[N+](=O)[O-] |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26 |
| RIDADR | UN 3261 8/PG 2 |
| HS Code | 2904909090 |
|
~92%
3-METHYL-4-NITR... CAS#:141281-38-1 |
| Literature: Dhanoa, Daljit S.; Bagley, Scott W.; Chang, Raymond S. L.; Lotti, Victor J.; Chen, Tsing-Bau; et al. Journal of Medicinal Chemistry, 1993 , vol. 36, # 26 p. 4239 - 4249 |
|
~%
3-METHYL-4-NITR... CAS#:141281-38-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 36, # 26 p. 4239 - 4249 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-methyl-4-nitrobenzyl bromide |