2-(3-cyclopentyl-1-propyn-1-yl)adenosine structure
|
Common Name | 2-(3-cyclopentyl-1-propyn-1-yl)adenosine | ||
|---|---|---|---|---|
| CAS Number | 141345-10-0 | Molecular Weight | 373.40600 | |
| Density | 1.63g/cm3 | Boiling Point | 740.1ºC at 760mmHg | |
| Molecular Formula | C18H23N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 401.4ºC | |
| Name | (2R,3R,4S,5R)-2-[6-amino-2-(3-cyclopentylprop-1-ynyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 740.1ºC at 760mmHg |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.40600 |
| Flash Point | 401.4ºC |
| Exact Mass | 373.17500 |
| PSA | 139.54000 |
| LogP | 0.53300 |
| Vapour Pressure | 5.35E-23mmHg at 25°C |
| Index of Refraction | 1.763 |
| InChIKey | ACTXLGWFGGOOKX-XKLVTHTNSA-N |
| SMILES | Nc1nc(C#CCC2CCCC2)nc2c1ncn2C1OC(CO)C(O)C1O |
|
~69%
2-(3-cyclopenty... CAS#:141345-10-0 |
| Literature: Yamasa Shoyu Kabushiki Kaisha Patent: US5189027 A1, 1993 ; |
|
~%
2-(3-cyclopenty... CAS#:141345-10-0 |
| Literature: Abiru; Miyashita; Watanabe; Yamaguchi; Machida; Matsuda Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2253 - 2260 |
|
~%
2-(3-cyclopenty... CAS#:141345-10-0 |
| Literature: Abiru; Miyashita; Watanabe; Yamaguchi; Machida; Matsuda Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2253 - 2260 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Cpp-adenosine |
| Adenosine,2-(3-cyclopentyl-1-propynyl)-(9CI) |
| 2-(3-Cyclopentyl-1-propyn-1-yl)adenosine |
| 2-(3-cyclopentyl-1-propynyl)adenosine |