4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol structure
|
Common Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 14151-63-4 | Molecular Weight | 242.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O2 |
|---|---|
| Molecular Weight | 242.31300 |
| Exact Mass | 242.13100 |
| PSA | 40.46000 |
| LogP | 3.73210 |
| InChIKey | HFRAJYYHALXFLZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)c2ccc(O)cc2)ccc1O |
|
Name: Agonist activity at human Gal4-ERbeta at 10 uM by reporter gene assay relative to 17b...
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL2406171
|
|
Name: Antagonist activity at human Gal4-ERbeta assessed as inhibition of 17beta-estradiol-i...
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL2406169
|
|
Name: Agonist activity at human Gal4-ERalpha at 10 uM by reporter gene assay relative to 17...
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL2406175
|
|
Name: Antagonist activity at human Gal4-ERalpha assessed as inhibition of 17beta-estradiol-...
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL2406172
|
| Phenol,4-[1-(4-hydroxyphenyl)-1-methylethyl]-2-methyl |
| 2-Methyl-4.4'-isopropyliden-bisphenol |
| 2-(4-hydroxy-3-methylphenyl)-2-(4'-hydroxyphenyl)propane |
| 2-(3-methyl-4-hydroxyphenyl)-2-(4-hydroxyphenyl)propane |