Amino-PEG11-acid
Modify Date: 2025-11-03 21:31:07
Amino-PEG11-acid structure
|
Common Name | Amino-PEG11-acid | ||
|---|---|---|---|---|
| CAS Number | 1415408-69-3 | Molecular Weight | 617.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H55NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amino-PEG11-acidAmino-PEG12-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Amino-PEG12-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Amino-PEG12-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C27H55NO14 |
|---|---|
| Molecular Weight | 617.72 |
| InChIKey | NLXRBQLQDLAFIM-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| MFCD11041150 |