EGR240 structure
|
Common Name | EGR240 | ||
|---|---|---|---|---|
| CAS Number | 1415683-79-2 | Molecular Weight | 168.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EGR240EGR240 is a branched-chain amino acid aminotransferase 1 (BCAT1) inhibitor. EGR240 can be used for the research of cancer, rheumatoid arthritis, and bone disease[1]. |
| Name | Hexanoic acid, 4-methyl-5-oxo-, sodium salt (1:1) |
|---|
| Description | EGR240 is a branched-chain amino acid aminotransferase 1 (BCAT1) inhibitor. EGR240 can be used for the research of cancer, rheumatoid arthritis, and bone disease[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C7H13NaO3 |
|---|---|
| Molecular Weight | 168.17 |
| InChIKey | QEQCTLAIARYMND-UHFFFAOYSA-M |
| SMILES | CC(=O)C(C)CCC(=O)[O-].[Na+] |