2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate
Modify Date: 2025-08-27 20:43:08
2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate structure
|
Common Name | 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 14159-50-3 | Molecular Weight | 298.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4Cl4O3S |
|---|---|
| Molecular Weight | 298.0 |
| InChIKey | BVMLNPMHWQAYLX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1C(Cl)=C(Cl)C(Cl)=C1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: SMILES notation of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is CS(=O)(=O)OC1C(Cl)=C(Cl)C(Cl)=C1Cl. |
| Q: What is the Chinese name of 14159-50-3? |
| A: Chinese name of 14159-50-3 is 14159-50-3. |
| Q: What is the English name of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: The English name of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate. |
| Q: What is the InChIKey of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: InChIKey of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is BVMLNPMHWQAYLX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: CAS number of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is 14159-50-3. |
| Q: What is the molecular formula of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: Molecular formula of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is C6H4Cl4O3S. |
| Q: What is the molecular weight of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate? |
| A: Molecular weight of 2,4-Cyclopentadien-1-ol, 2,3,4,5-tetrachloro-, 1-methanesulfonate is 298.0. |