1-methyl-3,5-ditert-butyl-pyrazole structure
|
Common Name | 1-methyl-3,5-ditert-butyl-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 141665-18-1 | Molecular Weight | 194.31600 | |
| Density | 0.89g/cm3 | Boiling Point | 242.2ºC at 760mmHg | |
| Molecular Formula | C12H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.3ºC | |
| Name | 3,5-ditert-butyl-1-methylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.89g/cm3 |
|---|---|
| Boiling Point | 242.2ºC at 760mmHg |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.31600 |
| Flash Point | 100.3ºC |
| Exact Mass | 194.17800 |
| PSA | 17.82000 |
| LogP | 3.01510 |
| Vapour Pressure | 0.0536mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | HOPUBWIABHRCKQ-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(C)(C)C)cc1C(C)(C)C |
|
~86%
1-methyl-3,5-di... CAS#:141665-18-1 |
| Literature: Abboud, J.-L. M.; Cabildo, P.; Canada, T.; Catalan, J.; Claramunt, R. M.; et al. Journal of Organic Chemistry, 1992 , vol. 57, # 14 p. 3938 - 3946 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Methyl-3,5-di-t-butylpyrazole |
| 1-methyl-3,5-di-tert-butylpyrazole |