Glutathione oxidized-13C4,15N2 structure
|
Common Name | Glutathione oxidized-13C4,15N2 | ||
|---|---|---|---|---|
| CAS Number | 1416898-83-3 | Molecular Weight | 618.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C1613C4H32N415N2O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glutathione oxidized-13C4,15N2Glutathione oxidized (GSSG)-13C4,15N2 is the 13C and 15N labeled Glutathione oxidized (HY-D0844). Glutathione oxidized is produced by the oxidation of glutathione. Detoxification of reactive oxygen species is accompanied by production of glutathione oxidized. Glutathione oxidized can be used for the research of sickle cells and erythrocytes[1][2]. |
| Name | Glutathione oxidized-13C4,15N2 |
|---|
| Description | Glutathione oxidized (GSSG)-13C4,15N2 is the 13C and 15N labeled Glutathione oxidized (HY-D0844). Glutathione oxidized is produced by the oxidation of glutathione. Detoxification of reactive oxygen species is accompanied by production of glutathione oxidized. Glutathione oxidized can be used for the research of sickle cells and erythrocytes[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| Molecular Formula | C1613C4H32N415N2O12S2 |
|---|---|
| Molecular Weight | 618.59 |
| InChIKey | YPZRWBKMTBYPTK-IXOPVCMUSA-N |
| SMILES | NC(CCC(=O)NC(CSSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(=O)NCC(=O)O)C(=O)O |