(R)-1-Boc-3-methanesulfonyloxypyrrolidine structure
|
Common Name | (R)-1-Boc-3-methanesulfonyloxypyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 141699-57-2 | Molecular Weight | 265.32700 | |
| Density | 1.25 g/cm3 | Boiling Point | 392.882ºC at 760 mmHg | |
| Molecular Formula | C10H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.408ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-Methanesulfonyloxy-pyrrolidine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25 g/cm3 |
|---|---|
| Boiling Point | 392.882ºC at 760 mmHg |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.32700 |
| Flash Point | 191.408ºC |
| Exact Mass | 265.09800 |
| PSA | 81.29000 |
| LogP | 1.99070 |
| Vapour Pressure | 2.22E-06mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | KWQRKOSMSFLBTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~97%
(R)-1-Boc-3-met... CAS#:141699-57-2 |
| Literature: CENTAURUS BIOPHARMA CO., LTD.; XIAO, Dengming; ZHU, Li; HU, Yuandong; YU, Rong; HU, Wei; ZHAO, Na; PENG, Yong; LUO, Hong; HAN, Yongxin Patent: WO2013/97773 A1, 2013 ; Location in patent: Paragraph 0150 ; |
|
~64%
(R)-1-Boc-3-met... CAS#:141699-57-2 |
| Literature: ASTRAZENECA AB Patent: WO2006/73366 A1, 2006 ; Location in patent: Page/Page column 185 ; WO 2006/073366 A1 |
|
~%
(R)-1-Boc-3-met... CAS#:141699-57-2 |
| Literature: US2011/212102 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 3-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate |
| 1-BOC-3-METHANESULFONYLOXYPYRROLIDINE |
| 3-methanesulfonyloxypyrrolidine-1-carboxylic acid tert-butyl ester |
| (R)-1-Boc-3-methanesulfonyloxypyrrolidine |