Butyl 4-Carboxyphenyl Carbonate structure
|
Common Name | Butyl 4-Carboxyphenyl Carbonate | ||
|---|---|---|---|---|
| CAS Number | 14180-12-2 | Molecular Weight | 238.23700 | |
| Density | 1.218g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | 140ºC | |
| MSDS | N/A | Flash Point | 145.4ºC | |
| Name | Butyl 4-Carboxyphenyl Carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Melting Point | 140ºC |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.23700 |
| Flash Point | 145.4ºC |
| Exact Mass | 238.08400 |
| PSA | 72.83000 |
| LogP | 2.70030 |
| Vapour Pressure | 1.51E-06mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | GNBKEARJFHTJMV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Oc1ccc(C(=O)O)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-((Butoxycarbonyl)oxy)benzoic acid |
| 4-CARBOXYPHENYL BUTYL CARBONATE |
| 4-butoxycarbonyloxybenzoic acid |