Minaxin C structure
|
Common Name | Minaxin C | ||
|---|---|---|---|---|
| CAS Number | 1418150-06-7 | Molecular Weight | 542.57 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 631.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H38O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6±25.0 °C | |
Use of Minaxin CMinaxin C is a natural cassane-type diterpene[1]. |
| Name | (1R,2S,3aS,3bS,4R,5S,5aR,9S,9aS,9bS,11aR)-1,2,5a,11a-tetrahydroxy-3a,6,6,9a-tetramethyl-11-oxohexadecahydrophenanthro[1,2-b]furan-4,5,9-triyl triacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Minaxin C is a natural cassane-type diterpene[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 631.8±55.0 °C at 760 mmHg |
| Molecular Formula | C26H38O12 |
| Molecular Weight | 542.57 |
| Flash Point | 202.6±25.0 °C |
| Exact Mass | 542.236328 |
| PSA | 186.12000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | LOMSKYVSYSPQIL-IFANGNRESA-N |
| SMILES | CC(=O)OC1C2C(CC(=O)C3(O)C(O)C(O)OC23C)C2(C)C(OC(C)=O)CCC(C)(C)C2(O)C1OC(C)=O |
| Hazard Codes | Xi |
|---|
| Phenanthro[1,2-b]furan-11(2H)-one, 4,5,9-tris(acetyloxy)tetradecahydro-1,2,5a,11a-tetrahydroxy-3a,6,6,9a-tetramethyl-, (1R,2S,3aS,3bS,4R,5S,5aR,9S,9aS,9bS,11aR)- |
| (1R,2S,3aS,3bS,4R,5S,5aR,9S,9aS,9bS,11aR)-1,2,5a,11a-Tetrahydroxy-3a,6,6,9a-tetramethyl-11-oxohexadecahydrophenanthro[1,2-b]furan-4,5,9-triyl triacetate |