2,5-dichloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one structure
|
Common Name | 2,5-dichloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 141917-51-3 | Molecular Weight | 336.21100 | |
| Density | 1.31g/cm3 | Boiling Point | 400.2ºC at 760 mmHg | |
| Molecular Formula | C14H19Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 2,5-dichloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 400.2ºC at 760 mmHg |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.21100 |
| Flash Point | 195.8ºC |
| Exact Mass | 335.06900 |
| PSA | 48.00000 |
| LogP | 1.83240 |
| Vapour Pressure | 1.3E-06mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | KEIYAGYJHSHTTO-UHFFFAOYSA-N |
| SMILES | C=CCC1(Cl)C(=O)C(Cl)=C(N2CCOCC2)C1(OC)OC |
|
~83%
2,5-dichloro-4,... CAS#:141917-51-3 |
| Literature: Tolstikov, G.A.; Ismailov, S.A.; Prishchepova, E.V.; Miftakhov, M.S. Journal of Organic Chemistry USSR (English Translation), 1991 , vol. 27, # 11.1 p. 2069 - 2074 Zhurnal Organicheskoi Khimii, 1991 , vol. 27, # 11 p. 2334 - 2340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS2798F16 |
| 2,5-dichloro-3-morpholino-4,4-dimethoxy-5-allyl-2-cyclopentenone |