1,2-cyclohexanedione, mono[(4-chlorophenyl)hydrazone] structure
|
Common Name | 1,2-cyclohexanedione, mono[(4-chlorophenyl)hydrazone] | ||
|---|---|---|---|---|
| CAS Number | 14192-45-1 | Molecular Weight | 236.69700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-cyclohexanedione, mono[(4-chlorophenyl)hydrazone] |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13ClN2O |
|---|---|
| Molecular Weight | 236.69700 |
| Exact Mass | 236.07200 |
| PSA | 41.46000 |
| LogP | 3.32400 |
| InChIKey | HQTYVILHKAIYRW-PTNGSMBKSA-N |
| SMILES | O=C1CCCCC1=NNc1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
|
~49%
1,2-cyclohexane... CAS#:14192-45-1 |
| Literature: WO2004/110999 A1, ; Page 27-28 ; |
|
~49%
1,2-cyclohexane... CAS#:14192-45-1 |
| Literature: WO2005/5386 A1, ; Page 27-28 ; |
|
~%
1,2-cyclohexane... CAS#:14192-45-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 14, # 9 p. 2942 - 2955 |
|
~%
1,2-cyclohexane... CAS#:14192-45-1 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 48, # 2 p. 331 - 338 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Cyclohexan-1,2-dion-monophenylhydrazon |
| 1,2-cyclohexanedion dioxime |
| NIOXIME |
| cyclohexane-1,2-dione dioxime |
| cyclohexane-1,2-dione-mono-phenylhydrazone |
| Nioxim |
| cyclohexanedione-1,2-dioxime |
| cyclohexane-1,2-dione phenylhydrazone |
| 1,2-Cyclohexanedione,dioxime |
| 1,2-Cyclohexanedione,1,2-dioxime |