Sodium octyl sulfate structure
|
Common Name | Sodium octyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 142-31-4 | Molecular Weight | 232.273 | |
| Density | 1.04 g/ml | Boiling Point | N/A | |
| Molecular Formula | C8H17NaO4S | Melting Point | 195 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 93.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Sodium octyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04 g/ml |
|---|---|
| Melting Point | 195 °C (dec.)(lit.) |
| Molecular Formula | C8H17NaO4S |
| Molecular Weight | 232.273 |
| Flash Point | 93.3 °C |
| Exact Mass | 232.074524 |
| PSA | 74.81000 |
| LogP | 2.90450 |
| InChIKey | WFRKJMRGXGWHBM-UHFFFAOYSA-M |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Stability | Stable. Incompatible with oxidizing agents. |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | WT1175000 |
| HS Code | 29209010 |
|
~93%
Sodium octyl sulfate CAS#:142-31-4 |
| Literature: Pogorevc, Mateja; Faber, Kurt Tetrahedron Asymmetry, 2002 , vol. 13, # 13 p. 1435 - 1441 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Assessment of the role of multidrug resistance-associated proteins in MPTP neurotoxicity in mice.
Ideggyogy. Sz. 66(11-12) , 407-14, (2014) The available scientific data indicate that the pathomechanism of Parkinson's disease (PD) involves the accumulation of endogenous and exogenous toxic substances. The disruption of the proper function... |
|
|
Effects of neurotoxin 1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine (MPTP) treatment on ovarian development of the sapphire devil, Chrysiptera cyanea.
Fish Physiol. Biochem. 41(1) , 61-71, (2015) In the neuroendocrine system controlling fish reproduction, dopamine (DA) acts as a gonadotropin inhibitory factor and plays a role in regulating gonadal development of certain species. The present st... |
|
|
Striatal dopamine receptor plasticity in neurotensin deficient mice.
Behav. Brain Res. 280 , 160-71, (2014) Schizophrenia is thought to be caused, at least in part, by dysfunction in striatal dopamine neurotransmission. Both clinical studies and animal research have implicated the dopamine neuromodulator ne... |
| Octyl sulfate,sodium salt |
| Octyl sulfate sodium salt |
| EINECS 205-535-5 |
| Sulfuric acid, octyl ester, sodium salt (1:1) |
| sodium,octyl sulfate |
| Sodium octyl sulfate |
| Sodium n-octyl sulfate |
| MFCD00007470 |