sodium decyl sulfate structure
|
Common Name | sodium decyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 142-87-0 | Molecular Weight | 260.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NaO4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | sodium decyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21NaO4S |
|---|---|
| Molecular Weight | 260.32600 |
| Exact Mass | 260.10600 |
| PSA | 74.81000 |
| LogP | 3.68470 |
| InChIKey | XZTJQQLJJCXOLP-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Stability | Stable. Incompatible with oxidizing agents, acids. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22;R36;R37;R38;R41 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | WS7625000 |
| HS Code | 3402110000 |
|
~%
sodium decyl sulfate CAS#:142-87-0 |
| Literature: Journal of Physical Chemistry, , vol. 93, # 1 p. 367 - 372 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Multi-target spectral moment QSAR versus ANN for antiparasitic drugs against different parasite species.
Bioorg. Med. Chem. 18 , 2225-31, (2010) There are many of pathogen parasite species with different susceptibility profile to antiparasitic drugs. Unfortunately, almost QSAR models predict the biological activity of drugs against only one pa... |
|
|
The role of amphiphilicity and negative charge in glycoprotein 41 interactions in the hydrophobic pocket.
J. Med. Chem. 52 , 4338-44, (2009) The hydrophobic pocket within the coiled coil domain of HIV-1 gp41 is considered to be a hot-spot suitable for small molecule intervention of fusion, although so far it has yielded only microM inhibit... |
| Sodium n-Decyl Sulfate |
| Sodium decyl sulfate |
| Decyl sulfate sodium salt |
| EINECS 205-568-5 |
| MFCD00041881 |
| Decyl sodium sulfate |
| sodium,decyl sulfate |