(S)-Donepezil structure
|
Common Name | (S)-Donepezil | ||
|---|---|---|---|---|
| CAS Number | 142057-80-5 | Molecular Weight | 379.49 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 527.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H29NO3 | Melting Point | 206.72° C | |
| MSDS | N/A | Flash Point | 273.1±30.1 °C | |
Use of (S)-Donepezil(S)-Donepezil is a S-enantiomer of Donepezil (HY-14566). Donepezil is a specific and potent AChE inhibitor[1][2]. |
| Name | (-)-Donepezil |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Donepezil is a S-enantiomer of Donepezil (HY-14566). Donepezil is a specific and potent AChE inhibitor[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 527.9±50.0 °C at 760 mmHg |
| Melting Point | 206.72° C |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.49 |
| Flash Point | 273.1±30.1 °C |
| Exact Mass | 379.214752 |
| LogP | 4.71 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | ADEBPBSSDYVVLD-FQEVSTJZSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2 |
| (2S)-2-[(1-Benzyl-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone |
| (2S)-2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one |
| donepezil |
| (S)-2,3-Dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-1H-Inden-1-one |
| (S)-donepezil |
| 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-, (2S)- |