Shizukaol C structure
|
Common Name | Shizukaol C | ||
|---|---|---|---|---|
| CAS Number | 142279-41-2 | Molecular Weight | 634.71 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 838.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H42O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.0±27.8 °C | |
Use of Shizukaol CShizukaol C is a dimeric sesquiterpene isolated from the roots of Chloranthus serratus[1]. |
| Name | shizukaol C |
|---|---|
| Synonym | More Synonyms |
| Description | Shizukaol C is a dimeric sesquiterpene isolated from the roots of Chloranthus serratus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 838.4±65.0 °C at 760 mmHg |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.71 |
| Flash Point | 266.0±27.8 °C |
| Exact Mass | 634.277771 |
| PSA | 156.66000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | KDKIOCIPCJDWMT-ADSFGAOYSA-N |
| SMILES | CC=C(C)C(=O)OCC1(O)C2CC2C2(C)C1CC1=C(CO)C(=O)OC13C1C(=C(C)C(=O)OC)C(=O)C(O)C4(C)C1=C(CC32)C1CC14 |
| Hazard Codes | Xi |
|---|
| [(1aR,1bS,2R,4Z,4aR,4bS,8aR,9S,9aS,10aR,10bS,10cS,11bS)-2,9-Dihydroxy-7-(hydroxymethyl)-4-(1-methoxy-1-oxo-2-propanylidene)-1b,10b-dimethyl-3,6-dioxo-1,1a,1b,2,3,4,4a,6,8,8a,9,9a,10,10a,10b,10c,11,11b-octadecahydrocyclopropa[4,5]cyclopropa[4',5']cyclopenta[1',2':7,8]acephenanthryleno[10a,10-b]furan-9-yl]methyl (2E)-2-methyl-2-butenoate |
| 1-Hexanesulfonothioic acid,S-hexyl ester |
| 2-Butenoic acid, 2-methyl-, [(1aR,1bS,2R,4Z,4aR,4bS,8aR,9S,9aS,10aR,10bS,10cS,11bS)-1,1a,1b,2,3,4,4a,6,8,8a,9,9a,10,10a,10b,10c,11,11b-octadecahydro-2,9-dihydroxy-7-(hydroxymethyl)-4-(2-methoxy-1-methyl-2-oxoethylidene)-1b,10b-dimethyl-3,6-dioxocyclopropa[4,5]cyclopropa[4',5']cyclopent[1',2':7,8]acephenanthryleno[10a,10-b]furan-9-yl]methyl ester, (2E)- |
| S-hexyl hexanethiosulfonate |