(3-nitrophenyl) carbonochloridate structure
|
Common Name | (3-nitrophenyl) carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 14235-05-3 | Molecular Weight | 201.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-nitrophenyl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4ClNO4 |
|---|---|
| Molecular Weight | 201.56400 |
| Exact Mass | 200.98300 |
| PSA | 72.12000 |
| LogP | 2.85560 |
| InChIKey | JAYFJCQVACHCGU-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1cccc([N+](=O)[O-])c1 |
|
~%
(3-nitrophenyl)... CAS#:14235-05-3 |
| Literature: IRM LLC; NOVARTIS, AG Patent: WO2007/38669 A2, 2007 ; Location in patent: Page/Page column 170 ; |
|
~%
(3-nitrophenyl)... CAS#:14235-05-3 |
| Literature: Chacon, Almary; Masterson, Douglas S.; Yin, Huiyong; Liebler, Daniel C.; Porter, Ned A. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 18 p. 6213 - 6222 |
|
~%
(3-nitrophenyl)... CAS#:14235-05-3 |
| Literature: Oesper; Broker; Cook Journal of the American Chemical Society, 1925 , vol. 47, p. 2609 |
|
~%
(3-nitrophenyl)... CAS#:14235-05-3 |
| Literature: Hoechster Farbw. Patent: DE287805 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-nitrophenyl chloroformate |
| 3-nitrophenyloxycarbonyl chloride |
| m-nitrophenyl chloroformate |
| m-nitrophenoxycarbonyl chloride |
| Carbonochloridic acid,3-nitrophenyl ester |