bis(3-nitrophenyl) carbonate structure
|
Common Name | bis(3-nitrophenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 5676-72-2 | Molecular Weight | 304.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-nitrophenyl) carbonate |
|---|
| Molecular Formula | C13H8N2O7 |
|---|---|
| Molecular Weight | 304.21200 |
| Exact Mass | 304.03300 |
| PSA | 127.17000 |
| LogP | 4.12720 |
| InChIKey | GDOLZIOIEBBPMT-UHFFFAOYSA-N |
| SMILES | O=C(Oc1cccc([N+](=O)[O-])c1)Oc1cccc([N+](=O)[O-])c1 |
| HS Code | 2920909090 |
|---|
|
~%
bis(3-nitrophen... CAS#:5676-72-2 |
| Literature: Oesper; Broker; Cook Journal of the American Chemical Society, 1925 , vol. 47, p. 2609 |
|
~%
bis(3-nitrophen... CAS#:5676-72-2 |
| Literature: Vlasak, Petr; Parik, Patrik; Klicnar, Jiri; Mindl, Jaromir Collection of Czechoslovak Chemical Communications, 1998 , vol. 63, # 6 p. 793 - 802 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |