flufenacet structure
|
Common Name | flufenacet | ||
|---|---|---|---|---|
| CAS Number | 142459-58-3 | Molecular Weight | 363.331 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 401.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H13F4N3O2S | Melting Point | 75-77ºC | |
| MSDS | Chinese USA | Flash Point | 196.6±31.5 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | flufenacet |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.5±55.0 °C at 760 mmHg |
| Melting Point | 75-77ºC |
| Molecular Formula | C14H13F4N3O2S |
| Molecular Weight | 363.331 |
| Flash Point | 196.6±31.5 °C |
| Exact Mass | 363.066467 |
| PSA | 83.56000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | IANUJLZYFUDJIH-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)COc1nnc(C(F)(F)F)s1)c1ccc(F)cc1 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H373-H410 |
| Precautionary Statements | P273-P280-P301 + P312 + P330-P333 + P313-P391-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R43;R48/22 |
| Safety Phrases | S13-S24-S37-S60 |
| RIDADR | UN 3077 |
| RTECS | AC2845000 |
| HS Code | 2934999010 |
| HS Code | 2934999010 |
|---|---|
| Summary | 2934999010. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:20.0% |
|
Development of EPA method 535 for the determination of chloroacetanilide and other acetamide herbicide degradates in drinking water by solid-phase extraction and liquid chromatography/tandem mass spectrometry.
J. AOAC Int. 89(1) , 201-9, (2006) U.S. Environmental Protection Agency (EPA) Method 535 has been developed in order to provide a method for the analysis of "Alachlor ESA and other acetanilide degradation products," which are listed on... |
|
|
Flufenacet herbicide treatment phenocopies the fiddlehead mutant in Arabidopsis thaliana.
Pest Manag. Sci. 59(8) , 847-56, (2003) In order to study the mode of action of herbicides we conducted a pilot study analysing phenotype and gene expression of flufenacet- and benfuresate-treated Arabidopsis thaliana (L) Heynhoe plants. Tr... |
|
|
Flufenacet soil persistence and mobility in corn and wheat crops.
Bull. Environ. Contam. Toxicol. 63(4) , 460-6, (1999)
|
| 4'-Fluoro-N-isopropyl-2-(5-trifluoromethyl-1,3,4-thiadiazol-2-yloxy)acetanilide |
| Foe 5043 |
| BAY FOE 5043 |
| N-(4-Fluorophenyl)-N-isopropyl-2-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yloxy]acetamide |
| Fluthiamide |
| flufenacet |
| N-(4-Fluorophenyl)-N-(1-methylethyl)-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]acetamide |
| T5NN DSJ CXFFF EO1VNR DF&Y1&1 |
| Fluthiamid |
| Thiafluamide |
| Acetamide, N-(4-fluorophenyl)-N-(1-methylethyl)-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]- |
| 8787751 |
| 4’-fluoro-N-isopropyl-2-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yloxy]acetanilide |
| BAY-FOE 5043 |
| N-(4-fluorophenyl)-N-propan-2-yl-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]acetamide |
| N-Isopropyl-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)-(4'-fluorooxyacetanilide) |
| N-(4-fluorophenyl)-N-(propan-2-yl)-2-{[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy}acetamide |
| N-(4-Fluorophenyl)-N-isopropyl-2-{[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy}acetamide |