5'''-O-Feruloyl complanatoside B structure
|
Common Name | 5'''-O-Feruloyl complanatoside B | ||
|---|---|---|---|---|
| CAS Number | 142473-98-1 | Molecular Weight | 932.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H48O23 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'''-O-Feruloyl complanatoside B5'''-O-Feruloyl complanatoside B is isolated from Astragali Semen, the seeds of Astragalus Complanatus. Semen Astragali Complanati (SAC) include fatty acids, amino acids, polysaccharides, flavonoids, triterpene glycosides and trace elements; have been reported to involve in chronic diseases such as cardiovascular diseases, diabetes mellitus and cancers[1][2]. |
| Name | 5'''-O-Feruloyl complanatoside B |
|---|
| Description | 5'''-O-Feruloyl complanatoside B is isolated from Astragali Semen, the seeds of Astragalus Complanatus. Semen Astragali Complanati (SAC) include fatty acids, amino acids, polysaccharides, flavonoids, triterpene glycosides and trace elements; have been reported to involve in chronic diseases such as cardiovascular diseases, diabetes mellitus and cancers[1][2]. |
|---|---|
| Related Catalog |
| Molecular Formula | C43H48O23 |
|---|---|
| Molecular Weight | 932.83 |
| InChIKey | UTPCLOFGDXGRFY-KVDBRUDJSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC3OC(CO)C(O)C(O)C3OC3OCC(O)(COC(=O)C=Cc4ccc(O)c(OC)c4)C3O)c(-c3ccc(OC4OC(CO)C(O)C(O)C4O)cc3)oc2c1 |