glyasperin a structure
|
Common Name | glyasperin a | ||
|---|---|---|---|---|
| CAS Number | 142474-52-0 | Molecular Weight | 422.470 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 643.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±25.0 °C | |
Use of glyasperin aGlyasperin A is a flavonoid compound isolated from the acetone extract of the leaves of Macaranga gigantea[1]. |
| Name | 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-6-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Glyasperin A is a flavonoid compound isolated from the acetone extract of the leaves of Macaranga gigantea[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 643.0±55.0 °C at 760 mmHg |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.470 |
| Flash Point | 219.4±25.0 °C |
| Exact Mass | 422.172943 |
| PSA | 111.13000 |
| LogP | 6.24 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | XHCCZOWAHHBCAK-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(-c2oc3cc(O)c(CC=C(C)C)c(O)c3c(=O)c2O)ccc1O |
| Hazard Codes | Xi |
|---|
| 3,5,7-Trihydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-6-(3-methyl-2-buten-1-yl)-4H-chromen-4-one |
| Glyasperin A |
| 3,5,7-Trihydroxy-2-(4-hydroxy-3-(3-methyl-but-2-enyl)-phenyl)-6-((Z)-3-methyl-but-2-enyl)-1-benzopyran-4-one |
| 3,5,7-Trihydroxy-2-[4-hydroxy-3-(3-methyl-but-2-enyl)-phenyl]-6-((Z)-3-methyl-but-2-enyl)-1-benzopyran-4-one |