Glyasperin D structure
|
Common Name | Glyasperin D | ||
|---|---|---|---|---|
| CAS Number | 142561-10-2 | Molecular Weight | 370.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glyasperin DGlyasperin D is a flavonoid isolated from Glycyrrhiza uralensis, and possesses weaker anti-Helicobacter pylori activity[1]. |
| Name | glyasperin D |
|---|
| Description | Glyasperin D is a flavonoid isolated from Glycyrrhiza uralensis, and possesses weaker anti-Helicobacter pylori activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H26O5 |
|---|---|
| Molecular Weight | 370.43900 |
| Exact Mass | 370.17800 |
| PSA | 68.15000 |
| LogP | 4.34240 |
| InChIKey | DDMAUIOCNQXFHL-AWEZNQCLSA-N |
| SMILES | COc1cc2c(c(OC)c1CC=C(C)C)CC(c1ccc(O)cc1O)CO2 |
| Hazard Codes | Xi |
|---|