6-chloro-6-deoxy-d-mannose structure
|
Common Name | 6-chloro-6-deoxy-d-mannose | ||
|---|---|---|---|---|
| CAS Number | 14257-40-0 | Molecular Weight | 366.74800 | |
| Density | 1.33g/cm3 | Boiling Point | 406.4ºC at 760 mmHg | |
| Molecular Formula | C14H19ClO9 | Melting Point | 69-71ºC | |
| MSDS | N/A | Flash Point | 144.2ºC | |
| Name | Chloro 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 406.4ºC at 760 mmHg |
| Melting Point | 69-71ºC |
| Molecular Formula | C14H19ClO9 |
| Molecular Weight | 366.74800 |
| Flash Point | 144.2ºC |
| Exact Mass | 366.07200 |
| PSA | 114.43000 |
| LogP | 0.30830 |
| Vapour Pressure | 8.15E-07mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | BYWPSIUIJNAJDV-DGTMBMJNSA-N |
| SMILES | CC(=O)OCC1OC(Cl)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Storage condition | Store below -20C |
| Stability | Store in Freezer, Stabilized with 2% Calcium Carbonate |
| Hazard Codes | Xi: Irritant; |
|---|
| 6-chloro-6-deoxy-d-mannose |