Daphylloside structure
|
Common Name | Daphylloside | ||
|---|---|---|---|---|
| CAS Number | 14260-99-2 | Molecular Weight | 446.402 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 678.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H26O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7±25.0 °C | |
Use of DaphyllosideDaphylloside is an iridoid isolated from the aerial parts of Galium verum. |
| Name | Methyl (1S,4aS,5S,7aS)-7-(acetoxymethyl)-1-(β-D-glucopyranosyloxy )-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Daphylloside is an iridoid isolated from the aerial parts of Galium verum. |
|---|---|
| Related Catalog | |
| In Vitro | Daphylloside may show some antioxidant effects. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 678.3±55.0 °C at 760 mmHg |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.402 |
| Flash Point | 237.7±25.0 °C |
| Exact Mass | 446.142426 |
| PSA | 181.44000 |
| LogP | -2.47 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | YSOBQIMODQOGKQ-HOZAMIDDSA-N |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(COC(C)=O)=CC(O)C12 |
| Storage condition | 2-8℃ |
| daphylloside |
| Cyclopenta[c]pyran-4-carboxylic acid, 7-[(acetyloxy)methyl]-1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-, methyl ester, (1S,4aS,5S,7aS)- |
| asperulosidic acid methyl ester |
| Asperulosid |
| RUBICHLORIC ACID |
| Methyl (1S,4aS,5S,7aS)-7-(acetoxymethyl)-1-(β-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| methyl (1S,4aS,5S,7aS)-7-[(acetyloxy)methyl]-1-(β-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |