Acetic acid, [[(1,1-dimethylethoxy)carbonyl]amino](dimethoxyphosphinyl)-, ethyl ester structure
|
Common Name | Acetic acid, [[(1,1-dimethylethoxy)carbonyl]amino](dimethoxyphosphinyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 142602-46-8 | Molecular Weight | 311.26900 | |
| Density | N/A | Boiling Point | 411.59ºC at 760 mmHg | |
| Molecular Formula | C11H22NO7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.723ºC | |
| Name | Ethyl (dimethoxyphosphoryl)({[(2-methyl-2-propanyl)oxy]carbonyl}a mino)acetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 411.59ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H22NO7P |
| Molecular Weight | 311.26900 |
| Flash Point | 202.723ºC |
| Exact Mass | 311.11300 |
| PSA | 113.46000 |
| LogP | 2.09060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | MUICEMIMMHJMGE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)P(=O)(OC)OC |
|
~%
Acetic acid, [[... CAS#:142602-46-8 |
| Literature: Vartak, Ashish P.; Skoblenick, Kevin; Thomas, Nancy; Mishra, Ram K.; Johnson, Rodney L. Journal of Medicinal Chemistry, 2007 , vol. 50, # 26 p. 6725 - 6729 |
| N-(tert-butoxycarbonyl)-S-methyl-L-cysteine |
| S-Methyl-N-t-butyloxycarbonyl-L-cysteine |
| N-(tert-butoxycarbonyl)-1-amino-1-(carboxymethyl)phosphonic acid dimethyl ester |
| N-Boc-S-methyl-L-cysteine |
| (2R)-2-[(tert-butoxycarbonyl)amino]-3-(methylsulfanyl)propanoic acid |
| Boc-S-methyl-L-cysteine |
| ethyl N-Boc-2-(dimethylphosphono)glycinate |
| S(Me)NH(Boc)Cys |
| N-(tert-butoxycarbonyl)-S-methylcysteine |
| N-butoxycarbonyl-(R)-methylthioaniline |
| BOC-CYS(ME)-OH |
| (R)-2-(N-tert-butoxycarbonylamino)-3-methylthiopropanoic acid |