L-703014 structure
|
Common Name | L-703014 | ||
|---|---|---|---|---|
| CAS Number | 142638-79-7 | Molecular Weight | 442.55100 | |
| Density | 1.2g/cm3 | Boiling Point | 809.7ºC at 760mmHg | |
| Molecular Formula | C24H34N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 443.5ºC | |
Use of L-703014L-703014 is a fibrinogen receptor antagonist, with the IC50 of 94 nM, that acts as a novel parenteral and potential oral antithrombotic agent[1][2]. |
| Name | (3R)-5-(1H-indol-3-yl)-3-[[2-(4-piperidin-4-ylbutanoylamino)acetyl]amino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | L-703014 is a fibrinogen receptor antagonist, with the IC50 of 94 nM, that acts as a novel parenteral and potential oral antithrombotic agent[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 809.7ºC at 760mmHg |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.55100 |
| Flash Point | 443.5ºC |
| Exact Mass | 442.25800 |
| PSA | 130.30000 |
| LogP | 4.35550 |
| Vapour Pressure | 1.06E-27mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | CEYGRENFNCKRRG-LJQANCHMSA-N |
| SMILES | O=C(O)CC(CCc1c[nH]c2ccccc12)NC(=O)CNC(=O)CCCC1CCNCC1 |
| l 703,014 |