JWH 018 N-(1,2-dimethylpropyl) isomer structure
|
Common Name | JWH 018 N-(1,2-dimethylpropyl) isomer | ||
|---|---|---|---|---|
| CAS Number | 1427325-40-3 | Molecular Weight | 341.445 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 518.6±23.0 °C at 760 mmHg | |
| Molecular Formula | C24H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5±22.6 °C | |
Use of JWH 018 N-(1,2-dimethylpropyl) isomerJWH 018 N-(1,2-dimethylpropyl) isomer differs from JWH 018 structurally by having a 1,2-dimethylpropyl chain, rather than a pentyl chain, extending from the indole group. |
| Name | [1-(1,2-dimethylpropyl)indol-3-yl]-(1-naphthyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.6±23.0 °C at 760 mmHg |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.445 |
| Flash Point | 267.5±22.6 °C |
| Exact Mass | 341.177979 |
| PSA | 22.00000 |
| LogP | 6.49 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | JERJAAHYNIGGSX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)n1cc(C(=O)c2cccc3ccccc23)c2ccccc21 |
| [1-(3-Methyl-2-butanyl)-1H-indol-3-yl](1-naphthyl)methanone |
| Methanone, [1-(1,2-dimethylpropyl)-1H-indol-3-yl]-1-naphthalenyl- |