N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-4-fluoro-2-nitroaniline structure
|
Common Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-4-fluoro-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 142744-16-9 | Molecular Weight | 353.41200 | |
| Density | 1.299g/cm3 | Boiling Point | 479ºC at 760 mmHg | |
| Molecular Formula | C16H20FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-4-fluoro-2-nitroaniline |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 479ºC at 760 mmHg |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.41200 |
| Flash Point | 243.5ºC |
| Exact Mass | 353.12100 |
| PSA | 99.53000 |
| LogP | 4.33000 |
| Vapour Pressure | 2.46E-09mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | NEZXWTGSAGKVIL-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1ccc(CSCCNc2ccc(F)cc2[N+](=O)[O-])o1 |
|
~68%
N-[2-[[5-[(dime... CAS#:142744-16-9 |
| Literature: Valli, Matthew J.; Tang, Yunzhao; Kosh, J. W.; Chapman, James M.; Sowell, J. Walter Journal of Medicinal Chemistry, 1992 , vol. 35, # 17 p. 3141 - 3147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |