2,4,6-Trimethylphenylglyoxal hydrate structure
|
Common Name | 2,4,6-Trimethylphenylglyoxal hydrate | ||
|---|---|---|---|---|
| CAS Number | 142751-35-7 | Molecular Weight | 194.22700 | |
| Density | N/A | Boiling Point | 369.5ºC at 760 mmHg | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | 2,4,6-Trimethylphenylglyoxal hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 369.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Flash Point | 177.3ºC |
| Exact Mass | 194.09400 |
| PSA | 57.53000 |
| LogP | 1.10520 |
| Vapour Pressure | 4.11E-06mmHg at 25°C |
| InChIKey | SBIUCNOOFPPMNX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)C=O)c(C)c1.O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-oxo-2-(2,4,6-trimethylphenyl)acetaldehyde,hydrate |