1-CHLORO-4-PROPOXY-9H-THIOXANTHEN-9-ONE structure
|
Common Name | 1-CHLORO-4-PROPOXY-9H-THIOXANTHEN-9-ONE | ||
|---|---|---|---|---|
| CAS Number | 142770-42-1 | Molecular Weight | 304.79100 | |
| Density | 1.319g/cm3 | Boiling Point | 467.4ºC at 760 mmHg | |
| Molecular Formula | C16H13ClO2S | Melting Point | 100.0-103.0ºC | |
| MSDS | Chinese USA | Flash Point | 99-103ºC(lit.) | |
| Name | 1-chloro-4-propoxythioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 467.4ºC at 760 mmHg |
| Melting Point | 100.0-103.0ºC |
| Molecular Formula | C16H13ClO2S |
| Molecular Weight | 304.79100 |
| Flash Point | 99-103ºC(lit.) |
| Exact Mass | 304.03200 |
| PSA | 54.54000 |
| LogP | 4.85690 |
| Vapour Pressure | 6.53E-09mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | VKQJCUYEEABXNK-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(Cl)c2c(=O)c3ccccc3sc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Identification of print-related contaminants in food packaging.
Food Addit. Contam. Part A. Chem. Anal. Control. Expo. Risk Assess. 33 , 518-29, (2016) Since the UV ink photoinitiator (PI) isopropylthioxanthone (ITX) was discovered in packaged milk, studies of print contamination have focused primarily on PIs but have also included amine synergists. ... |
| 1-chloro-4-propyloxy-thioxanthone |
| 9H-Thioxanthen-9-one,1-chloro-4-propoxy |
| 1-Chloro-4-propoxythioxanthone |
| 1-Chloro-4-propoxy-9H-thioxanthen-9-one |
| 1-Chloro-4-n-propoxythioxanthone |