Tos-L-Arg-NH2 * HCl structure
|
Common Name | Tos-L-Arg-NH2 * HCl | ||
|---|---|---|---|---|
| CAS Number | 14279-64-2 | Molecular Weight | 363.863 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22ClN5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tos-Arg-NH2 HCl |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22ClN5O3S |
|---|---|
| Molecular Weight | 363.863 |
| Exact Mass | 363.113190 |
| PSA | 159.54000 |
| LogP | 3.55540 |
| InChIKey | ULGNEWYDCYUHJH-MERQFXBCSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCN=C(N)N)C(N)=O)cc1.Cl |
|
~%
Tos-L-Arg-NH2 * HCl CAS#:14279-64-2 |
| Literature: Bergmann; Fruton; Pollok Journal of Biological Chemistry, 1939 , vol. 127, p. 643,647 |
|
~%
Tos-L-Arg-NH2 * HCl CAS#:14279-64-2 |
| Literature: Bergmann; Fruton; Pollok Journal of Biological Chemistry, 1939 , vol. 127, p. 643,647 |
|
~%
Tos-L-Arg-NH2 * HCl CAS#:14279-64-2 |
| Literature: Bergmann; Fruton; Pollok Journal of Biological Chemistry, 1939 , vol. 127, p. 643,647 |
|
~%
Tos-L-Arg-NH2 * HCl CAS#:14279-64-2 |
| Literature: Bergmann; Fruton; Pollok Journal of Biological Chemistry, 1939 , vol. 127, p. 643,647 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N-[(4-Methylphenyl)sulfonyl]-L-argininamide hydrochloride (1:1) |
| Pentanamide, 5-[(aminoiminomethyl)amino]-2-[[(4-methylphenyl)sulfonyl]amino]-, (2S)-, hydrochloride (1:1) |
| (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide,hydrochloride |