(2-M-TOLYL-ETHYL)-HYDRAZINEHYDROCHLORIDE structure
|
Common Name | (2-M-TOLYL-ETHYL)-HYDRAZINEHYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 1428-53-1 | Molecular Weight | 263.15000 | |
| Density | 1.597g/cm3 | Boiling Point | 411.5ºC at 760mmHg | |
| Molecular Formula | C9H6F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760mmHg |
| Molecular Formula | C9H6F3N2O4 |
| Molecular Weight | 263.15000 |
| Exact Mass | 263.02800 |
| PSA | 97.98000 |
| LogP | 1.37160 |
| Vapour Pressure | 1.65E-07mmHg at 25°C |
| InChIKey | DBPSLLDEGNZGLQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-Nitro-4-trifluormethyl-phenylglycin |