(2-M-TOLYL-ETHYL)-HYDRAZINE structure
|
Common Name | (2-M-TOLYL-ETHYL)-HYDRAZINE | ||
|---|---|---|---|---|
| CAS Number | 175137-69-6 | Molecular Weight | 211.19800 | |
| Density | 1.5g/cm3 | Boiling Point | 453ºC at 760 mmHg | |
| Molecular Formula | C7H5N3O3S | Melting Point | 128.5ºC | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 2-hydroxyimino-2-pyridin-2-ylsulfonylacetonitrile |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 453ºC at 760 mmHg |
| Melting Point | 128.5ºC |
| Molecular Formula | C7H5N3O3S |
| Molecular Weight | 211.19800 |
| Flash Point | 227.7ºC |
| Exact Mass | 211.00500 |
| PSA | 111.79000 |
| LogP | 1.24738 |
| Vapour Pressure | 5.4E-09mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | YGMWCSZEJYENBM-YFHOEESVSA-N |
| SMILES | N#CC(=NO)S(=O)(=O)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |