N-(4-Chlorophenyl)cyclohexanecarboxamide structure
|
Common Name | N-(4-Chlorophenyl)cyclohexanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 142810-49-9 | Molecular Weight | 237.725 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 413.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9±24.0 °C | |
| Name | N-(4-Chlorophenyl)cyclohexanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.6±28.0 °C at 760 mmHg |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.725 |
| Flash Point | 203.9±24.0 °C |
| Exact Mass | 237.092041 |
| PSA | 29.10000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | RVJKIPFPMXENNO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CCCCC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclohexanecarboxamide, N-(4-chlorophenyl)- |
| N-(4-Chlorophenyl)cyclohexanecarboxamide |