1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid structure
|
Common Name | 1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 142818-02-8 | Molecular Weight | 236.19100 | |
| Density | 1.34g/cm3 | Boiling Point | 305ºC at 760 mmHg | |
| Molecular Formula | C9H11F3N2O2 | Melting Point | 115-117ºC | |
| MSDS | N/A | Flash Point | 138.3ºC | |
| Name | 1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 305ºC at 760 mmHg |
| Melting Point | 115-117ºC |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19100 |
| Flash Point | 138.3ºC |
| Exact Mass | 236.07700 |
| PSA | 55.12000 |
| LogP | 2.35510 |
| Vapour Pressure | 0.000369mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | LBPZUNLSYYEDFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)n1ncc(C(=O)O)c1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~81%
1-tert-butyl-5-... CAS#:142818-02-8 |
| Literature: Anderson, Kevin William; Fotouhi, Nader; Gillespie, Paul; Goodnow, Robert Alan; Guertin, Kevin Richard; Haynes, Nancy-Ellen; Myers, Michael Paul; Pietranico-Cole, Sherrie Lynn; Qi, Lida; Rossman, Pamela Loreen; Scott, Nathan Robert; Thakkar, Kshitij Chhabilbhai; Tilley, Jefferson Wright; Zhang, Qiang Patent: US2007/225280 A1, 2007 ; Location in patent: Page/Page column 18; 34 ; US 20070225280 A1 |
|
~85%
1-tert-butyl-5-... CAS#:142818-02-8 |
| Literature: Okada, Etsuji; Masuda, Ryoichi; Hojo, Masaru Heterocycles, 1992 , vol. 34, # 4 p. 791 - 798 |
|
~%
1-tert-butyl-5-... CAS#:142818-02-8 |
| Literature: Heterocycles, , vol. 34, # 4 p. 791 - 798 |
|
~%
1-tert-butyl-5-... CAS#:142818-02-8 |
| Literature: Heterocycles, , vol. 34, # 4 p. 791 - 798 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butyl-5-trifluoromethyl-1H-pyrazole-4-carboxylic acid |
| 1-(t-butyl)-5-trifluoromethylpyrazole-4-carboxylic acid |