2,6-dichloro-3,5-bis(trifluoromethyl)pyridine structure
|
Common Name | 2,6-dichloro-3,5-bis(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 142889-02-9 | Molecular Weight | 283.98600 | |
| Density | 1.271g/cm3 | Boiling Point | 107ºC 127mm | |
| Molecular Formula | C7HCl2F6N | Melting Point | 75-77ºC | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | 2,6-dichloro-3,5-bis(trifluoromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 107ºC 127mm |
| Melting Point | 75-77ºC |
| Molecular Formula | C7HCl2F6N |
| Molecular Weight | 283.98600 |
| Flash Point | 209.7ºC |
| Exact Mass | 282.93900 |
| PSA | 12.89000 |
| LogP | 4.42600 |
| Vapour Pressure | 6.44E-08mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | BGWXTSKOBMAJMO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(Cl)nc1Cl |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,4,5,6-pentamethylbenzyl alcohol |