N-methyl-N'-(4-methylphenyl)propanediamide structure
|
Common Name | N-methyl-N'-(4-methylphenyl)propanediamide | ||
|---|---|---|---|---|
| CAS Number | 142917-15-5 | Molecular Weight | 206.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-N'-(4-methylphenyl)propanediamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O2 |
|---|---|
| Molecular Weight | 206.24100 |
| Exact Mass | 206.10600 |
| PSA | 61.69000 |
| LogP | 1.98290 |
| InChIKey | CDHQGNGRRSZHQP-UHFFFAOYSA-N |
| SMILES | CNC(=O)CC(=O)Nc1ccc(C)cc1 |
|
~%
N-methyl-N'-(4-... CAS#:142917-15-5 |
| Literature: West Journal of the Chemical Society, 1925 , vol. 127, p. 753 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Malonsaeure-methylamid-p-toluidid |
| N-methyl-N'-p-tolyl-malonamide |