Benzaldehyde,2-chloro-, 2-(4-nitrophenyl)hydrazone structure
|
Common Name | Benzaldehyde,2-chloro-, 2-(4-nitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 14295-17-1 | Molecular Weight | 275.69000 | |
| Density | 1.31g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C13H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | N-[(2-chlorophenyl)methylideneamino]-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.69000 |
| Flash Point | 220.2ºC |
| Exact Mass | 275.04600 |
| PSA | 70.21000 |
| LogP | 4.29040 |
| Vapour Pressure | 5.89E-08mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | VYNDYTODNXRKJN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2Cl)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| chlorobenzaldehyde (p-nitrophenyl)-hydrazone |
| Benzaldehyde,2-chloro-,2-(4-nitrophenyl)hydrazone |
| 2-chloro-benzaldehyde-(4-nitro-phenylhydrazone) |
| 2-Chlor-benzaldehyd-(4-nitro-phenylhydrazon) |
| (2-Chlor-benzyliden)-(4-nitro-phenylhydrazin) |
| 1-(2-chlorobenzylidene)-2-(4-nitrophenyl)hydrazine |