Benzaldehyde,2-(4-nitrophenyl)hydrazone structure
|
Common Name | Benzaldehyde,2-(4-nitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 3078-09-9 | Molecular Weight | 241.24500 | |
| Density | 1.2g/cm3 | Boiling Point | 410.4ºC at 760mmHg | |
| Molecular Formula | C13H11N3O2 | Melting Point | 195 °C | |
| MSDS | Chinese USA | Flash Point | 202ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | benzaldehyde 4-nitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 410.4ºC at 760mmHg |
| Melting Point | 195 °C |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.24500 |
| Flash Point | 202ºC |
| Exact Mass | 241.08500 |
| PSA | 70.21000 |
| LogP | 3.63700 |
| Index of Refraction | 1.608 |
| InChIKey | NOIFWEYOLLHIMW-GXDHUFHOSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~99%
Benzaldehyde,2-... CAS#:3078-09-9 |
| Literature: Wang, Yingchun; Yi, Xianghui; Qin, Wen Asian Journal of Chemistry, 2012 , vol. 24, # 1 p. 217 - 219 |
|
~82%
Benzaldehyde,2-... CAS#:3078-09-9 |
| Literature: Barrett, Ian C.; Langille, Jonathan D.; Kerr, Michael A. Journal of Organic Chemistry, 2000 , vol. 65, # 19 p. 6268 - 6269 |
|
~%
Benzaldehyde,2-... CAS#:3078-09-9 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 144, p. 291,305 |
|
~%
Detail
|
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 144, p. 291,305 |
|
~%
Detail
|
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 131, p. 182,183, 185, 190, 191 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| Benzaldehyde,(p-nitrophenyl)hydrazone (8ci) |
| Benzal-4-nitrophenylhydrazone |
| (4-nitrophenylhydrazono)(phenyl)methane |
| N-benzylidene-N'-(3-nitrophenyl) hydrazine |
| Benzaldehyde,2-(4-nitrophenyl)hydrazone |
| benzaldehyde-(4-nitro-phenylhydrazone) |
| MFCD00024596 |
| N-benzylidene-N'-(4-nitrophenyl)hydrazine |
| (3-nitrophenyl hydrazono)(phenyl) methane |
| BENZALDEHYDE (4-NITROPHENYL)HYDRAZONE |
| BENZALDEHYDE P-NITROPHENYL-HYDRAZONE |