5,5-bis[(4-nitrophenyl)methylsulfanylmethyl]imidazolidine-2,4-dione
Modify Date: 2026-07-21 11:41:54
![5,5-bis[(4-nitrophenyl)methylsulfanylmethyl]imidazolidine-2,4-dione Structure](https://image.chemsrc.com/caspic/398/142979-86-0.png)
5,5-bis[(4-nitrophenyl)methylsulfanylmethyl]imidazolidine-2,4-dione structure
|
Common Name | 5,5-bis[(4-nitrophenyl)methylsulfanylmethyl]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 142979-86-0 | Molecular Weight | 462.49900 | |
| Density | 1.443g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H18N4O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-bis[(4-nitrophenyl)methylsulfanylmethyl]imidazolidine-2,4-dione |
|---|
| Density | 1.443g/cm3 |
|---|---|
| Molecular Formula | C19H18N4O6S2 |
| Molecular Weight | 462.49900 |
| Exact Mass | 462.06700 |
| PSA | 207.42000 |
| LogP | 4.21010 |
| Index of Refraction | 1.653 |
| InChIKey | FGSYJGZLKDLUQA-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(CSCc2ccc([N+](=O)[O-])cc2)(CSCc2ccc([N+](=O)[O-])cc2)N1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:32418-95-4
CAS#:142979-79-1
CAS#:100-11-8|
Name: Inhibition of HIV-1 RF viral production in MT-2 cells.
Source: ChEMBL
Target: Human immunodeficiency virus type 1 (RF/HAT ISOLATE)
External Id: CHEMBL712240
|
|
Name: Compound was tested for antiviral activity by measuring its ability to inhibit HIV in...
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL877286
|
|
Name: Compound was tested for antiviral activity by measuring its ability to inhibit HIV in...
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL656583
|
|
Name: Inhibition of HIV-1 RF induced cytotoxicity in MT-2 cells; Inactive.
Source: ChEMBL
Target: MT2
External Id: CHEMBL711406
|
Total 5, Current Page 1 of 1
1