(S)-(-)-N-Methoxymethyl-n-trimethylsilylmethyl-1-phenylethylamine structure
|
Common Name | (S)-(-)-N-Methoxymethyl-n-trimethylsilylmethyl-1-phenylethylamine | ||
|---|---|---|---|---|
| CAS Number | 143140-08-3 | Molecular Weight | 251.44000 | |
| Density | 0.926g/cm3 | Boiling Point | 259.4ºC at 760mmHg | |
| Molecular Formula | C14H25NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.7ºC | |
| Name | (S)-N-(Methoxymethyl)-1-phenyl-N-((trimethylsilyl)methyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.926g/cm3 |
|---|---|
| Boiling Point | 259.4ºC at 760mmHg |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.44000 |
| Flash Point | 110.7ºC |
| Exact Mass | 251.17100 |
| PSA | 12.47000 |
| LogP | 3.94920 |
| Vapour Pressure | 0.013mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | FRQGYHCIEIDEAD-ZDUSSCGKSA-N |
| SMILES | COCN(C[Si](C)(C)C)C(C)c1ccccc1 |
|
~69%
(S)-(-)-N-Metho... CAS#:143140-08-3 |
| Literature: Gerlach, Kai; Hoffmann; Wartchow Journal of the Chemical Society - Perkin Transactions 1, 1998 , # 22 p. 3867 - 3872 |
|
~%
(S)-(-)-N-Metho... CAS#:143140-08-3 |
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 22 p. 3867 - 3872 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| MFCD06798960 |
| (S)-(-)-N-Methoxymethyl-N-(trimethylsilyl)methyl-1-phenylethylamine |
| (1S)-N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)ethanamine |