N-(5-AMINO-2-METHOXYPHENYL)BENZAMIDE structure
|
Common Name | N-(5-AMINO-2-METHOXYPHENYL)BENZAMIDE | ||
|---|---|---|---|---|
| CAS Number | 14315-26-5 | Molecular Weight | 226.27400 | |
| Density | 1.21g/cm3 | Boiling Point | 339.1ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | 3-amino-N-(4-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 339.1ºC at 760 mmHg |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27400 |
| Flash Point | 158.9ºC |
| Exact Mass | 226.11100 |
| PSA | 55.12000 |
| LogP | 3.48370 |
| Vapour Pressure | 9.42E-05mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | SFMBQQUKFGHDDU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2cccc(N)c2)cc1 |
| HS Code | 2924299090 |
|---|
|
~56%
N-(5-AMINO-2-ME... CAS#:14315-26-5 |
| Literature: Clark; Lin; Sansom Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1534 - 1537 |
|
~%
N-(5-AMINO-2-ME... CAS#:14315-26-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 8 p. 1534 - 1537 |
|
~%
N-(5-AMINO-2-ME... CAS#:14315-26-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 8 p. 1534 - 1537 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-benz-p-toluidid |
| 3-amino-N-p-tolyl-benzamide |